C24H40N2O3S2 — CID 143816892
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(1-propylpiperidin-4-yl)thiophen-3-yl]methanone;methylsulfonylmethane (PubChem CID 143816892) has the molecular formula C24H40N2O3S2 and a molecular weight of 468.73 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(1-propylpiperidin-4-yl)thiophen-3-yl]methanone;methylsulfonylmethane.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(1-propylpiperidin-4-yl)thiophen-3-yl]methanone;methylsulfonylmethane |
|---|---|
| PubChem CID | 143816892 |
| Molecular Formula | C24H40N2O3S2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(1-propylpiperidin-4-yl)thiophen-3-yl]methanone;methylsulfonylmethane |
| SMILES | CCCN1CCC(c2cc(C(=O)N3CCCC4CCCCC43)cs2)CC1.CS(C)(=O)=O |
| InChI | InChI=1S/C22H34N2OS.C2H6O2S/c1-2-11-23-13-9-18(10-14-23)21-15-19(16-26-21)22(25)24-12-5-7-17-6-3-4-8-20(17)24;1-5(2,3)4/h15-18,20H,2-14H2,1H3;1-2H3 |
| InChIKey | FIXTUGZRPGZOJS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |