C26H39N3OS — CID 143816772
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-heptan-4-ylthiophen-3-yl)methanone;2-methylpyrimidine (PubChem CID 143816772) has the molecular formula C26H39N3OS and a molecular weight of 441.69 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-heptan-4-ylthiophen-3-yl)methanone;2-methylpyrimidine.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-heptan-4-ylthiophen-3-yl)methanone;2-methylpyrimidine |
|---|---|
| PubChem CID | 143816772 |
| Molecular Formula | C26H39N3OS |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-heptan-4-ylthiophen-3-yl)methanone;2-methylpyrimidine |
| SMILES | CCCC(CCC)c1cc(C(=O)N2CCCC3CCCCC32)cs1.Cc1ncccn1 |
| InChI | InChI=1S/C21H33NOS.C5H6N2/c1-3-8-17(9-4-2)20-14-18(15-24-20)21(23)22-13-7-11-16-10-5-6-12-19(16)22;1-5-6-3-2-4-7-5/h14-17,19H,3-13H2,1-2H3;2-4H,1H3 |
| InChIKey | NQGMLNLXLWLTQN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |