C26H45N3OS — CID 143816967
N-(2-aminoethyl)acetamide;1-[1-(5-heptan-4-ylthiophen-3-yl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 143816967) has the molecular formula C26H45N3OS and a molecular weight of 447.73 g/mol. Its IUPAC name is N-(2-aminoethyl)acetamide;1-[1-(5-heptan-4-ylthiophen-3-yl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | N-(2-aminoethyl)acetamide;1-[1-(5-heptan-4-ylthiophen-3-yl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 143816967 |
| Molecular Formula | C26H45N3OS |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | N-(2-aminoethyl)acetamide;1-[1-(5-heptan-4-ylthiophen-3-yl)ethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | C=C(c1csc(C(CCC)CCC)c1)N1CCCC2CCCCC21.CC(=O)NCCN |
| InChI | InChI=1S/C22H35NS.C4H10N2O/c1-4-9-19(10-5-2)22-15-20(16-24-22)17(3)23-14-8-12-18-11-6-7-13-21(18)23;1-4(7)6-3-2-5/h15-16,18-19,21H,3-14H2,1-2H3;2-3,5H2,1H3,(H,6,7) |
| InChIKey | NVVIMROGEKRNTO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |