C14H18BrNOS — CID 66849695
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromothiophen-3-yl)methanone (PubChem CID 66849695) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromothiophen-3-yl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 66849695 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-bromothiophen-3-yl)methanone |
| SMILES | O=C(c1csc(Br)c1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H18BrNOS/c15-13-8-11(9-18-13)14(17)16-7-3-5-10-4-1-2-6-12(10)16/h8-10,12H,1-7H2/t10-,12-/m1/s1 |
| InChIKey | GPWYKMSIVSQEPG-ZYHUDNBSSA-N |
| XLogP | 4.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |