C14H17Br2NOS — CID 51534111
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4,5-dibromothiophen-2-yl)methanone (PubChem CID 51534111) has the molecular formula C14H17Br2NOS and a molecular weight of 407.17 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4,5-dibromothiophen-2-yl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4,5-dibromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 51534111 |
| Molecular Formula | C14H17Br2NOS |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4,5-dibromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)N1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H17Br2NOS/c15-10-8-12(19-13(10)16)14(18)17-7-3-5-9-4-1-2-6-11(9)17/h8-9,11H,1-7H2/t9-,11+/m0/s1 |
| InChIKey | OUJQOLAZIPVBIK-GXSJLCMTSA-N |
| XLogP | 5.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |