C16H20BrNOS — CID 107036666
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-bromo-5-sulfanylphenyl)methanone (PubChem CID 107036666) has the molecular formula C16H20BrNOS and a molecular weight of 354.31 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-bromo-5-sulfanylphenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-bromo-5-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107036666 |
| Molecular Formula | C16H20BrNOS |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-bromo-5-sulfanylphenyl)methanone |
| SMILES | O=C(c1cc(S)ccc1Br)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H20BrNOS/c17-14-8-7-12(20)10-13(14)16(19)18-9-3-5-11-4-1-2-6-15(11)18/h7-8,10-11,15,20H,1-6,9H2/t11-,15-/m1/s1 |
| InChIKey | GZIOQCIYGVZAPO-IAQYHMDHSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|