C15H17BrFNO — CID 65320678
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(4-bromo-2-fluorophenyl)methanone (PubChem CID 65320678) has the molecular formula C15H17BrFNO and a molecular weight of 326.21 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(4-bromo-2-fluorophenyl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(4-bromo-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 65320678 |
| Molecular Formula | C15H17BrFNO |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(4-bromo-2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1F)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H17BrFNO/c16-11-6-7-12(13(17)9-11)15(19)18-8-2-4-10-3-1-5-14(10)18/h6-7,9-10,14H,1-5,8H2 |
| InChIKey | RJRUUQXPPSVMKK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |