C17H22BrNO — CID 81109880
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-bromo-5-methylphenyl)methanone (PubChem CID 81109880) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-bromo-5-methylphenyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-bromo-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 81109880 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-bromo-5-methylphenyl)methanone |
| SMILES | Cc1ccc(Br)c(C(=O)N2CCCC3CCCCC32)c1 |
| InChI | InChI=1S/C17H22BrNO/c1-12-8-9-15(18)14(11-12)17(20)19-10-4-6-13-5-2-3-7-16(13)19/h8-9,11,13,16H,2-7,10H2,1H3 |
| InChIKey | YREAGSOZZQAXPH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |