C17H24N2O — CID 102725157
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-amino-5-methylphenyl)methanone (PubChem CID 102725157) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-amino-5-methylphenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-amino-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 102725157 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-amino-5-methylphenyl)methanone |
| SMILES | Cc1cc(N)cc(C(=O)N2CCC[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C17H24N2O/c1-12-9-14(11-15(18)10-12)17(20)19-8-4-6-13-5-2-3-7-16(13)19/h9-11,13,16H,2-8,18H2,1H3/t13-,16-/m1/s1 |
| InChIKey | GHQFOQRVVPPOFG-CZUORRHYSA-N |
| XLogP | 3.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|