C17H20N4OS — CID 94589806
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methanone (PubChem CID 94589806) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 94589806 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2ncccn2)n1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H20N4OS/c22-17(21-10-3-6-12-5-1-2-7-14(12)21)13-11-23-16(20-13)15-18-8-4-9-19-15/h4,8-9,11-12,14H,1-3,5-7,10H2/t12-,14-/m0/s1 |
| InChIKey | PZHKDQABHGQEIX-JSGCOSHPSA-N |
| XLogP | 3.39 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |