C20H24N2OS2 — CID 58924892
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(2-methylsulfanylphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 58924892) has the molecular formula C20H24N2OS2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(2-methylsulfanylphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(2-methylsulfanylphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 58924892 |
| Molecular Formula | C20H24N2OS2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(2-methylsulfanylphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CSc1ccccc1-c1nc(C(=O)N2CCCC3CCCCC32)cs1 |
| InChI | InChI=1S/C20H24N2OS2/c1-24-18-11-5-3-9-15(18)19-21-16(13-25-19)20(23)22-12-6-8-14-7-2-4-10-17(14)22/h3,5,9,11,13-14,17H,2,4,6-8,10,12H2,1H3 |
| InChIKey | CAFJCDCDPDMKNL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |