C14H22ClN3OS — CID 119686916
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(aminomethyl)-1,3-thiazol-4-yl]methanone;hydrochloride (PubChem CID 119686916) has the molecular formula C14H22ClN3OS and a molecular weight of 315.87 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(aminomethyl)-1,3-thiazol-4-yl]methanone;hydrochloride.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(aminomethyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119686916 |
| Molecular Formula | C14H22ClN3OS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-(aminomethyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
| SMILES | Cl.NCc1nc(C(=O)N2CCCC3CCCCC32)cs1 |
| InChI | InChI=1S/C14H21N3OS.ClH/c15-8-13-16-11(9-19-13)14(18)17-7-3-5-10-4-1-2-6-12(10)17;/h9-10,12H,1-8,15H2;1H |
| InChIKey | SGKLCWGXKLCBQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |