C20H24N2OS — CID 9489559
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 9489559) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 9489559 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1ccc(-c2nc(C(=O)N3CCC[C@@H]4CCCC[C@@H]43)cs2)cc1 |
| InChI | InChI=1S/C20H24N2OS/c1-14-8-10-16(11-9-14)19-21-17(13-24-19)20(23)22-12-4-6-15-5-2-3-7-18(15)22/h8-11,13,15,18H,2-7,12H2,1H3/t15-,18-/m0/s1 |
| InChIKey | DVQSYFCEEFYROL-YJBOKZPZSA-N |
| XLogP | 4.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |