C23H35N3O2 — CID 142925414
1-[4-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-hexylurea (PubChem CID 142925414) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[4-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-hexylurea.
| Compound Name | 1-[4-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-hexylurea |
|---|---|
| PubChem CID | 142925414 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-[4-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]phenyl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)Nc1ccc(C(=O)N2CCC[C@@H]3CCCCC32)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-2-3-4-7-16-24-23(28)25-20-14-12-19(13-15-20)22(27)26-17-8-10-18-9-5-6-11-21(18)26/h12-15,18,21H,2-11,16-17H2,1H3,(H2,24,25,28)/t18-,21?/m0/s1 |
| InChIKey | RMVJADJTKBNDGK-YMXDCFFPSA-N |
| XLogP | 5.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|