C23H35N3O3 — CID 58707707
1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-pentylurea (PubChem CID 58707707) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-pentylurea.
| Compound Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-pentylurea |
|---|---|
| PubChem CID | 58707707 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1ccc(C(=O)N2CCC[C@H]3CCCC[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C23H35N3O3/c1-3-4-7-14-24-23(28)25-18-12-13-19(21(16-18)29-2)22(27)26-15-8-10-17-9-5-6-11-20(17)26/h12-13,16-17,20H,3-11,14-15H2,1-2H3,(H2,24,25,28)/t17-,20-/m1/s1 |
| InChIKey | IIVHVNZAZNWDEA-YLJYHZDGSA-N |
| XLogP | 4.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|