C22H33N3O3 — CID 142924949
1-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-butylurea (PubChem CID 142924949) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-butylurea.
| Compound Name | 1-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-butylurea |
|---|---|
| PubChem CID | 142924949 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-3-butylurea |
| SMILES | CCCCNC(=O)Nc1ccc(C(=O)N2CCCC3CCCC[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C22H33N3O3/c1-3-4-13-23-22(27)24-17-11-12-18(20(15-17)28-2)21(26)25-14-7-9-16-8-5-6-10-19(16)25/h11-12,15-16,19H,3-10,13-14H2,1-2H3,(H2,23,24,27)/t16?,19-/m1/s1 |
| InChIKey | QBDZDEACJQRBEP-LRTDYKAYSA-N |
| XLogP | 4.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|