C19H27N3O2 — CID 66794348
1-[3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-oxopropyl]-3-phenylurea (PubChem CID 66794348) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-oxopropyl]-3-phenylurea.
| Compound Name | 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-oxopropyl]-3-phenylurea |
|---|---|
| PubChem CID | 66794348 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-3-oxopropyl]-3-phenylurea |
| SMILES | O=C(NCCC(=O)N1CCCC2CCCCC21)Nc1ccccc1 |
| InChI | InChI=1S/C19H27N3O2/c23-18(22-14-6-8-15-7-4-5-11-17(15)22)12-13-20-19(24)21-16-9-2-1-3-10-16/h1-3,9-10,15,17H,4-8,11-14H2,(H2,20,21,24) |
| InChIKey | HZDDQVZASYTVNC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |