C18H24N4O3 — CID 17476451
1-[3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-oxopropyl]-3-phenylurea (PubChem CID 17476451) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-oxopropyl]-3-phenylurea.
| Compound Name | 1-[3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-oxopropyl]-3-phenylurea |
|---|---|
| PubChem CID | 17476451 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[3-[4-(cyclopropanecarbonyl)piperazin-1-yl]-3-oxopropyl]-3-phenylurea |
| SMILES | O=C(NCCC(=O)N1CCN(C(=O)C2CC2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C18H24N4O3/c23-16(8-9-19-18(25)20-15-4-2-1-3-5-15)21-10-12-22(13-11-21)17(24)14-6-7-14/h1-5,14H,6-13H2,(H2,19,20,25) |
| InChIKey | YEUUZHXUGKBJKG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |