C16H24BrClN4O2 — CID 119423845
1-[3-[4-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea;hydrochloride (PubChem CID 119423845) has the molecular formula C16H24BrClN4O2 and a molecular weight of 419.75 g/mol. Its IUPAC name is 1-[3-[4-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea;hydrochloride.
| Compound Name | 1-[3-[4-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119423845 |
| Molecular Formula | C16H24BrClN4O2 |
| Molecular Weight | 419.75 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-[3-[4-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea;hydrochloride |
| SMILES | Cl.NCC1CCN(C(=O)CCNC(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H23BrN4O2.ClH/c17-13-1-3-14(4-2-13)20-16(23)19-8-5-15(22)21-9-6-12(11-18)7-10-21;/h1-4,12H,5-11,18H2,(H2,19,20,23);1H |
| InChIKey | KWTSKFLBEQDUNV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |