C16H23BrN4O2 — CID 119469097
1-[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea (PubChem CID 119469097) has the molecular formula C16H23BrN4O2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 1-[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea.
| Compound Name | 1-[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea |
|---|---|
| PubChem CID | 119469097 |
| Molecular Formula | C16H23BrN4O2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]-3-(4-bromophenyl)urea |
| SMILES | NCC1CCCCN1C(=O)CCNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN4O2/c17-12-4-6-13(7-5-12)20-16(23)19-9-8-15(22)21-10-2-1-3-14(21)11-18/h4-7,14H,1-3,8-11,18H2,(H2,19,20,23) |
| InChIKey | ZNJXPHWJFDRCLZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |