C22H28N4O3 — CID 51129471
1-(4-ethoxyphenyl)-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]urea (PubChem CID 51129471) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51129471 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCC(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-2-29-20-10-8-18(9-11-20)24-22(28)23-13-12-21(27)26-16-14-25(15-17-26)19-6-4-3-5-7-19/h3-11H,2,12-17H2,1H3,(H2,23,24,28) |
| InChIKey | ICAKAGOGDDOYDE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |