C21H31N3O2 — CID 95269574
1-[(2S)-1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea (PubChem CID 95269574) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[(2S)-1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea.
| Compound Name | 1-[(2S)-1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 95269574 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-[(2S)-1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccccc1)C(=O)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H31N3O2/c1-15(2)19(23-21(26)22-17-11-4-3-5-12-17)20(25)24-14-8-10-16-9-6-7-13-18(16)24/h3-5,11-12,15-16,18-19H,6-10,13-14H2,1-2H3,(H2,22,23,26)/t16-,18-,19-/m0/s1 |
| InChIKey | SONFLGZJUSRPKS-WDSOQIARSA-N |
| XLogP | 4.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |