C22H32N4O3 — CID 55566978
1-[1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea (PubChem CID 55566978) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea.
| Compound Name | 1-[1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 55566978 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-[1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
| SMILES | CC(C)C(NC(=O)Nc1ccccc1)C(=O)N1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C22H32N4O3/c1-16(2)19(24-22(29)23-18-10-4-3-5-11-18)21(28)26-14-12-25(13-15-26)20(27)17-8-6-7-9-17/h3-5,10-11,16-17,19H,6-9,12-15H2,1-2H3,(H2,23,24,29) |
| InChIKey | QEAJSEMZKCVQTQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |