C16H22BrN3O2 — CID 42698489
1-(3-bromophenyl)-3-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea (PubChem CID 42698489) has the molecular formula C16H22BrN3O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 42698489 |
| Molecular Formula | C16H22BrN3O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(3-bromophenyl)-3-(3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea |
| SMILES | CC(C)C(NC(=O)Nc1cccc(Br)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H22BrN3O2/c1-11(2)14(15(21)20-8-3-4-9-20)19-16(22)18-13-7-5-6-12(17)10-13/h5-7,10-11,14H,3-4,8-9H2,1-2H3,(H2,18,19,22) |
| InChIKey | QRORWPDVSYWQFC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |