C25H38N4O3 — CID 55685241
1-[1-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-benzylurea (PubChem CID 55685241) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[1-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-benzylurea.
| Compound Name | 1-[1-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-benzylurea |
|---|---|
| PubChem CID | 55685241 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1-[1-[4-(azepane-1-carbonyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-benzylurea |
| SMILES | CC(C)C(NC(=O)NCc1ccccc1)C(=O)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C25H38N4O3/c1-19(2)22(27-25(32)26-18-20-10-6-5-7-11-20)24(31)29-16-12-21(13-17-29)23(30)28-14-8-3-4-9-15-28/h5-7,10-11,19,21-22H,3-4,8-9,12-18H2,1-2H3,(H2,26,27,32) |
| InChIKey | WFNDHIYNMSOEFT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |