C25H32ClN3O2 — CID 67299403
1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-(2-phenylethyl)urea (PubChem CID 67299403) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 67299403 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-(2-phenylethyl)urea |
| SMILES | CC(C)C(NC(=O)NCCc1ccccc1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H32ClN3O2/c1-18(2)23(28-25(31)27-15-12-19-6-4-3-5-7-19)24(30)29-16-13-21(14-17-29)20-8-10-22(26)11-9-20/h3-11,18,21,23H,12-17H2,1-2H3,(H2,27,28,31) |
| InChIKey | DKCQJLZFCPQSPK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |