C22H32ClN3O2 — CID 67300127
1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-cyclopentylurea (PubChem CID 67300127) has the molecular formula C22H32ClN3O2 and a molecular weight of 405.97 g/mol. Its IUPAC name is 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-cyclopentylurea.
| Compound Name | 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 67300127 |
| Molecular Formula | C22H32ClN3O2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-3-cyclopentylurea |
| SMILES | CC(C)C(NC(=O)NC1CCCC1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H32ClN3O2/c1-15(2)20(25-22(28)24-19-5-3-4-6-19)21(27)26-13-11-17(12-14-26)16-7-9-18(23)10-8-16/h7-10,15,17,19-20H,3-6,11-14H2,1-2H3,(H2,24,25,28) |
| InChIKey | MGJNMIWBUIOTAZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |