C24H32ClN3O2 — CID 122500263
(2R)-2-[[(R)-(benzylamino)-hydroxymethyl]amino]-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 122500263) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is (2R)-2-[[(R)-(benzylamino)-hydroxymethyl]amino]-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | (2R)-2-[[(R)-(benzylamino)-hydroxymethyl]amino]-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 122500263 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (2R)-2-[[(R)-(benzylamino)-hydroxymethyl]amino]-1-[4-(4-chlorophenyl)piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)[C@@H](N[C@H](O)NCc1ccccc1)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H32ClN3O2/c1-17(2)22(27-24(30)26-16-18-6-4-3-5-7-18)23(29)28-14-12-20(13-15-28)19-8-10-21(25)11-9-19/h3-11,17,20,22,24,26-27,30H,12-16H2,1-2H3/t22-,24-/m1/s1 |
| InChIKey | MTLRUOANESCNGZ-ISKFKSNPSA-N |
| XLogP | 3.73 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|