C24H27FN2O3 — CID 142925292
N-[4-[(8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-4-fluorobenzamide (PubChem CID 142925292) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-[4-[(8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[(8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 142925292 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[4-[(8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-methoxyphenyl]-4-fluorobenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(F)cc2)ccc1C(=O)N1CCCC2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H27FN2O3/c1-30-22-15-19(26-23(28)17-8-10-18(25)11-9-17)12-13-20(22)24(29)27-14-4-6-16-5-2-3-7-21(16)27/h8-13,15-16,21H,2-7,14H2,1H3,(H,26,28)/t16?,21-/m0/s1 |
| InChIKey | QKNCXNFQOZKYHW-MRNPHLECSA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |