C24H28ClN3O3 — CID 58707772
1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-chlorophenyl]-3-(3-methoxyphenyl)urea (PubChem CID 58707772) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-chlorophenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-chlorophenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 58707772 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-3-chlorophenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(C(=O)N3CCC[C@H]4CCCC[C@H]43)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-31-19-9-4-8-17(14-19)26-24(30)27-18-11-12-20(21(25)15-18)23(29)28-13-5-7-16-6-2-3-10-22(16)28/h4,8-9,11-12,14-16,22H,2-3,5-7,10,13H2,1H3,(H2,26,27,30)/t16-,22-/m1/s1 |
| InChIKey | IFXNHKUSVTWRFQ-OPAMFIHVSA-N |
| XLogP | 5.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |