C21H27N3O2 — CID 58724566
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-methoxyphenyl)-1-methylpyrazol-4-yl]methanone (PubChem CID 58724566) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-methoxyphenyl)-1-methylpyrazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-methoxyphenyl)-1-methylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 58724566 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-methoxyphenyl)-1-methylpyrazol-4-yl]methanone |
| SMILES | COc1cccc(-c2c(C(=O)N3CCCC4CCCCC43)cnn2C)c1 |
| InChI | InChI=1S/C21H27N3O2/c1-23-20(16-8-5-10-17(13-16)26-2)18(14-22-23)21(25)24-12-6-9-15-7-3-4-11-19(15)24/h5,8,10,13-15,19H,3-4,6-7,9,11-12H2,1-2H3 |
| InChIKey | LLRWMZDODIGXKP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |