C21H26ClN3O — CID 58724575
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-chloro-2-methylphenyl)-1-methylpyrazol-4-yl]methanone (PubChem CID 58724575) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-chloro-2-methylphenyl)-1-methylpyrazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-chloro-2-methylphenyl)-1-methylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 58724575 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-chloro-2-methylphenyl)-1-methylpyrazol-4-yl]methanone |
| SMILES | Cc1c(Cl)cccc1-c1c(C(=O)N2CCCC3CCCCC32)cnn1C |
| InChI | InChI=1S/C21H26ClN3O/c1-14-16(9-5-10-18(14)22)20-17(13-23-24(20)2)21(26)25-12-6-8-15-7-3-4-11-19(15)25/h5,9-10,13,15,19H,3-4,6-8,11-12H2,1-2H3 |
| InChIKey | AIWNTZBREBWTQA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |