C20H25ClN4O — CID 58724533
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-amino-4-chlorophenyl)-1-methylpyrazol-4-yl]methanone (PubChem CID 58724533) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-amino-4-chlorophenyl)-1-methylpyrazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-amino-4-chlorophenyl)-1-methylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 58724533 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-(3-amino-4-chlorophenyl)-1-methylpyrazol-4-yl]methanone |
| SMILES | Cn1ncc(C(=O)N2CCCC3CCCCC32)c1-c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C20H25ClN4O/c1-24-19(14-8-9-16(21)17(22)11-14)15(12-23-24)20(26)25-10-4-6-13-5-2-3-7-18(13)25/h8-9,11-13,18H,2-7,10,22H2,1H3 |
| InChIKey | SZZMBNFIYCKPLY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|