C16H20Cl2N2O — CID 107186081
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,3-dichlorophenyl)methanone (PubChem CID 107186081) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.26 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,3-dichlorophenyl)methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 107186081 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(5-amino-2,3-dichlorophenyl)methanone |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)N2CCC[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C16H20Cl2N2O/c17-13-9-11(19)8-12(15(13)18)16(21)20-7-3-5-10-4-1-2-6-14(10)20/h8-10,14H,1-7,19H2/t10-,14-/m1/s1 |
| InChIKey | DPZAXCFXXPLYAP-QMTHXVAHSA-N |
| XLogP | 4.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|