C25H31N3O4 — CID 142925279
1-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-(3-methoxyphenyl)urea (PubChem CID 142925279) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 142925279 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-[4-[(4aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(C(=O)N3CC[C@H]4CCCCC4C3)c(OC)c2)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-31-21-9-5-8-19(14-21)26-25(30)27-20-10-11-22(23(15-20)32-2)24(29)28-13-12-17-6-3-4-7-18(17)16-28/h5,8-11,14-15,17-18H,3-4,6-7,12-13,16H2,1-2H3,(H2,26,27,30)/t17-,18?/m1/s1 |
| InChIKey | XVSMIBPURMCTSL-QNSVNVJESA-N |
| XLogP | 5.00 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |