C28H37NO4 — CID 142925051
ethane;(4-methylphenyl) 2-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]acetate (PubChem CID 142925051) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is ethane;(4-methylphenyl) 2-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]acetate.
| Compound Name | ethane;(4-methylphenyl) 2-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 142925051 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | ethane;(4-methylphenyl) 2-[4-[(8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]-3-methoxyphenyl]acetate |
| SMILES | CC.COc1cc(CC(=O)Oc2ccc(C)cc2)ccc1C(=O)N1CCC2CCCC[C@H]2C1 |
| InChI | InChI=1S/C26H31NO4.C2H6/c1-18-7-10-22(11-8-18)31-25(28)16-19-9-12-23(24(15-19)30-2)26(29)27-14-13-20-5-3-4-6-21(20)17-27;1-2/h7-12,15,20-21H,3-6,13-14,16-17H2,1-2H3;1-2H3/t20?,21-;/m0./s1 |
| InChIKey | APAKRUQGCVMTGA-NPTNJNKCSA-N |
| XLogP | 5.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|