C24H39N3O3+2 — CID 8872002
1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone (PubChem CID 8872002) has the molecular formula C24H39N3O3+2 and a molecular weight of 417.59 g/mol. Its IUPAC name is 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone |
|---|---|
| PubChem CID | 8872002 |
| Molecular Formula | C24H39N3O3+2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CC(=O)N3CC[C@H]4CCCC[C@@H]4C3)CC2)cc1OC |
| InChI | InChI=1S/C24H37N3O3/c1-29-22-8-7-19(15-23(22)30-2)16-25-11-13-26(14-12-25)18-24(28)27-10-9-20-5-3-4-6-21(20)17-27/h7-8,15,20-21H,3-6,9-14,16-18H2,1-2H3/p+2/t20-,21-/m1/s1 |
| InChIKey | YCIMMOYZHUJSKJ-NHCUHLMSSA-P |
| XLogP | 0.03 |
| TPSA | 47.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |