C25H41N3O3+2 — CID 8829335
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone (PubChem CID 8829335) has the molecular formula C25H41N3O3+2 and a molecular weight of 431.62 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone |
|---|---|
| PubChem CID | 8829335 |
| Molecular Formula | C25H41N3O3+2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]ethanone |
| SMILES | COc1cc(C)c(C[NH+]2CC[NH+](CC(=O)N3CCC[C@H]4CCCC[C@H]43)CC2)cc1OC |
| InChI | InChI=1S/C25H39N3O3/c1-19-15-23(30-2)24(31-3)16-21(19)17-26-11-13-27(14-12-26)18-25(29)28-10-6-8-20-7-4-5-9-22(20)28/h15-16,20,22H,4-14,17-18H2,1-3H3/p+2/t20-,22-/m1/s1 |
| InChIKey | FMHLUTULVHBUSH-IFMALSPDSA-P |
| XLogP | 0.48 |
| TPSA | 47.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |