C24H41N3O3+2 — CID 11932447
2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11932447) has the molecular formula C24H41N3O3+2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11932447 |
| Molecular Formula | C24H41N3O3+2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 2-[4-[(4,5-dimethoxy-2-methylphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | COc1cc(C)c(C[NH+]2CC[NH+](CC(=O)N[C@H]3CCC[C@@H](C)[C@@H]3C)CC2)cc1OC |
| InChI | InChI=1S/C24H39N3O3/c1-17-7-6-8-21(19(17)3)25-24(28)16-27-11-9-26(10-12-27)15-20-14-23(30-5)22(29-4)13-18(20)2/h13-14,17,19,21H,6-12,15-16H2,1-5H3,(H,25,28)/p+2/t17-,19+,21+/m1/s1 |
| InChIKey | UMMVAGJGOZQNFA-LMNJBCLMSA-P |
| XLogP | 0.24 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |