C23H39N3O3+2 — CID 11932459
2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11932459) has the molecular formula C23H39N3O3+2 and a molecular weight of 405.58 g/mol. Its IUPAC name is 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11932459 |
| Molecular Formula | C23H39N3O3+2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CC(=O)N[C@@H]3CCC[C@H](C)[C@H]3C)CC2)cc1OC |
| InChI | InChI=1S/C23H37N3O3/c1-17-6-5-7-20(18(17)2)24-23(27)16-26-12-10-25(11-13-26)15-19-8-9-21(28-3)22(14-19)29-4/h8-9,14,17-18,20H,5-7,10-13,15-16H2,1-4H3,(H,24,27)/p+2/t17-,18+,20+/m0/s1 |
| InChIKey | LDOLCPYKNBMUKG-NLWGTHIKSA-P |
| XLogP | -0.07 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |