C22H35N3O3+2 — CID 11929235
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11929235) has the molecular formula C22H35N3O3+2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11929235 |
| Molecular Formula | C22H35N3O3+2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)C[NH+]2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)CCC[C@@H]1C |
| InChI | InChI=1S/C22H33N3O3/c1-16-4-3-5-19(17(16)2)23-22(26)14-25-10-8-24(9-11-25)13-18-6-7-20-21(12-18)28-15-27-20/h6-7,12,16-17,19H,3-5,8-11,13-15H2,1-2H3,(H,23,26)/p+2/t16-,17+,19-/m0/s1 |
| InChIKey | FPJCKRSBJXCXNH-SCTDSRPQSA-P |
| XLogP | -0.36 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |