C16H21Cl2NO — CID 18206629
2-(3,4-dichlorophenyl)-N-(2,3-dimethylcyclohexyl)acetamide (PubChem CID 18206629) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(2,3-dimethylcyclohexyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(2,3-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 18206629 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(2,3-dimethylcyclohexyl)acetamide |
| SMILES | CC1CCCC(NC(=O)Cc2ccc(Cl)c(Cl)c2)C1C |
| InChI | InChI=1S/C16H21Cl2NO/c1-10-4-3-5-15(11(10)2)19-16(20)9-12-6-7-13(17)14(18)8-12/h6-8,10-11,15H,3-5,9H2,1-2H3,(H,19,20) |
| InChIKey | DYMWAPBTCINEND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |