C15H18BrCl2NO — CID 106367187
N-[2-(bromomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 106367187) has the molecular formula C15H18BrCl2NO and a molecular weight of 379.13 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[2-(bromomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 106367187 |
| Molecular Formula | C15H18BrCl2NO |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[2-(bromomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NC1CCCCC1CBr |
| InChI | InChI=1S/C15H18BrCl2NO/c16-9-11-3-1-2-4-14(11)19-15(20)8-10-5-6-12(17)13(18)7-10/h5-7,11,14H,1-4,8-9H2,(H,19,20) |
| InChIKey | XSPWFLMXVOAVBM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|