C25H40N4O2+2 — CID 8917575
2-[4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 8917575) has the molecular formula C25H40N4O2+2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-[4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8917575 |
| Molecular Formula | C25H40N4O2+2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2-[4-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C[NH+]1CC[NH+](CC(=O)N2CCC[C@@H]3CCCC[C@@H]32)CC1 |
| InChI | InChI=1S/C25H38N4O2/c1-19-7-5-8-20(2)25(19)26-23(30)17-27-13-15-28(16-14-27)18-24(31)29-12-6-10-21-9-3-4-11-22(21)29/h5,7-8,21-22H,3-4,6,9-18H2,1-2H3,(H,26,30)/p+2/t21-,22-/m0/s1 |
| InChIKey | YJMWWTNBHRYXMN-VXKWHMMOSA-P |
| XLogP | 0.21 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |