C22H32N3O2+ — CID 8597170
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-benzoylpiperazin-1-ium-1-yl)ethanone (PubChem CID 8597170) has the molecular formula C22H32N3O2+ and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-benzoylpiperazin-1-ium-1-yl)ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-benzoylpiperazin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8597170 |
| Molecular Formula | C22H32N3O2+ |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(4-benzoylpiperazin-1-ium-1-yl)ethanone |
| SMILES | O=C(c1ccccc1)N1CC[NH+](CC(=O)N2CCC[C@@H]3CCCC[C@H]32)CC1 |
| InChI | InChI=1S/C22H31N3O2/c26-21(25-12-6-10-18-7-4-5-11-20(18)25)17-23-13-15-24(16-14-23)22(27)19-8-2-1-3-9-19/h1-3,8-9,18,20H,4-7,10-17H2/p+1/t18-,20+/m0/s1 |
| InChIKey | XXQBCOJDJRVWRG-AZUAARDMSA-O |
| XLogP | 1.21 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |