C19H27N4O3+ — CID 8597114
(2S)-1-[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]piperidine-2-carboxamide (PubChem CID 8597114) has the molecular formula C19H27N4O3+ and a molecular weight of 359.45 g/mol. Its IUPAC name is (2S)-1-[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 8597114 |
| Molecular Formula | C19H27N4O3+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2S)-1-[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCCN1C(=O)C[NH+]1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N4O3/c20-18(25)16-8-4-5-9-23(16)17(24)14-21-10-12-22(13-11-21)19(26)15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-14H2,(H2,20,25)/p+1/t16-/m0/s1 |
| InChIKey | DHJJVZLOLOZVFJ-INIZCTEOSA-O |
| XLogP | -1.11 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |