C14H17ClN2O2S — CID 9199923
(2R)-1-[2-(2-chlorophenyl)sulfanylacetyl]piperidine-2-carboxamide (PubChem CID 9199923) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is (2R)-1-[2-(2-chlorophenyl)sulfanylacetyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[2-(2-chlorophenyl)sulfanylacetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 9199923 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2R)-1-[2-(2-chlorophenyl)sulfanylacetyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCN1C(=O)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O2S/c15-10-5-1-2-7-12(10)20-9-13(18)17-8-4-3-6-11(17)14(16)19/h1-2,5,7,11H,3-4,6,8-9H2,(H2,16,19)/t11-/m1/s1 |
| InChIKey | PROASVSHUBOYSW-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |