C12H14ClNOS — CID 2341550
2-(2-chlorophenyl)sulfanyl-1-pyrrolidin-1-ylethanone (PubChem CID 2341550) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 2341550 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CSc1ccccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C12H14ClNOS/c13-10-5-1-2-6-11(10)16-9-12(15)14-7-3-4-8-14/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | GPMRAUGGTKRGFA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |