C14H17Cl2NOS — CID 112778036
1-(azepan-1-yl)-2-(2,6-dichlorophenyl)sulfanylethanone (PubChem CID 112778036) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-(2,6-dichlorophenyl)sulfanylethanone.
| Compound Name | 1-(azepan-1-yl)-2-(2,6-dichlorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 112778036 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 1-(azepan-1-yl)-2-(2,6-dichlorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1c(Cl)cccc1Cl)N1CCCCCC1 |
| InChI | InChI=1S/C14H17Cl2NOS/c15-11-6-5-7-12(16)14(11)19-10-13(18)17-8-3-1-2-4-9-17/h5-7H,1-4,8-10H2 |
| InChIKey | KRIULJCLSJUGMA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |