C13H18Cl2N2OS — CID 119374934
1-(4-aminopiperidin-1-yl)-2-(2-chlorophenyl)sulfanylethanone;hydrochloride (PubChem CID 119374934) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-2-(2-chlorophenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-(4-aminopiperidin-1-yl)-2-(2-chlorophenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 119374934 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-2-(2-chlorophenyl)sulfanylethanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)CSc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClN2OS.ClH/c14-11-3-1-2-4-12(11)18-9-13(17)16-7-5-10(15)6-8-16;/h1-4,10H,5-9,15H2;1H |
| InChIKey | AVHAVKSRAFBYNB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |